Compound Q&A

What industries use 1-Methoxynaphthalene-2-boronicacid (CAS: 252670-79-4)?

Answer

1-Methoxynaphthalene-2-boronicacid
1-Methoxynaphthalene-2-boronicacid is primarily used in the pharmaceutical industry for the synthesis of complex organic compounds. It also finds applications in the polymer industry for the production of functional polymers and in the semiconductor industry for the fabrication of thin films. Additionally, it can be used in sensor technology for detecting specific chemical species.

About

English Name 1-Methoxynaphthalene-2-boronicacid
Molecular Formula C11H11BO3
Molecular Weight 202.01 g/mol
SMILES O(C([H])([H])[H])C1=C(B(O[H])O[H])C([H])=C([H])C2=C([H])C([H])=C([H])C([H])=C21
InChIKey AKLWQLDKPYSCMT-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Methoxynaphthalene-2-boronicacid (CAS: 252670-79-4)?

1-Methoxynaphthalene-2-boronicacid is a solid with a crystalline form. It has a molecular weight of ...

Compound Q&A

How is 1-Methoxynaphthalene-2-boronicacid (CAS: 252670-79-4) typically synthesized?

1-Methoxynaphthalene-2-boronicacid can be synthesized from 1-methoxynaphthalene using boronic acids ...

Compound Q&A

What precautions should be taken when handling 1-Methoxynaphthalene-2-boronicacid (CAS: 252670-79-4)?

When handling 1-Methoxynaphthalene-2-boronicacid, appropriate personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...