Compound Q&A

What are the physical and chemical properties of 1-Methoxynaphthalene-2-boronicacid (CAS: 252670-79-4)?

Answer

1-Methoxynaphthalene-2-boronicacid
1-Methoxynaphthalene-2-boronicacid is a solid with a crystalline form. It has a molecular weight of approximately 221.24 g/mol. The compound is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. It is less reactive under normal conditions but can participate in boron-containing reactions. It has a melting point of about 133-134°C and is stable under normal storage conditions.

About

English Name 1-Methoxynaphthalene-2-boronicacid
Molecular Formula C11H11BO3
Molecular Weight 202.01 g/mol
SMILES O(C([H])([H])[H])C1=C(B(O[H])O[H])C([H])=C([H])C2=C([H])C([H])=C([H])C([H])=C21
InChIKey AKLWQLDKPYSCMT-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

How is 1-Methoxynaphthalene-2-boronicacid (CAS: 252670-79-4) typically synthesized?

1-Methoxynaphthalene-2-boronicacid can be synthesized from 1-methoxynaphthalene using boronic acids ...

Compound Q&A

What industries use 1-Methoxynaphthalene-2-boronicacid (CAS: 252670-79-4)?

1-Methoxynaphthalene-2-boronicacid is primarily used in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling 1-Methoxynaphthalene-2-boronicacid (CAS: 252670-79-4)?

When handling 1-Methoxynaphthalene-2-boronicacid, appropriate personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...