Compound Q&A

What industries use DO3AM-acetic acid (CAS: 913528-04-8)?

Answer

DO3AM-acetic acid
DO3AM-acetic acid (CAS: 913528-04-8) is primarily used in the pharmaceutical industry for the synthesis of active pharmaceutical ingredients, in polymer chemistry for functionalizing surfaces, and in the production of sensors and semiconductors for electronic applications.

About

English Name DO3AM-acetic acid
Molecular Formula C16H31N7O5
Molecular Weight 401.46 g/mol
SMILES C1CN(CCN(CCN(CCN1CC(=O)N)CC(=O)N)CC(=O)O)CC(=O)N
InChIKey DFPHZEYJGWLQJE-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of DO3AM-acetic acid (CAS: 913528-04-8)?

DO3AM-acetic acid (CAS: 913528-04-8) is a white crystalline powder with a molecular weight of approx...

Compound Q&A

How is DO3AM-acetic acid (CAS: 913528-04-8) typically synthesized?

DO3AM-acetic acid is synthesized through the acetylation of DO3AM (dodecyl-3-aminomethyl propionic a...

Compound Q&A

What precautions should be taken when handling DO3AM-acetic acid (CAS: 913528-04-8)?

When handling DO3AM-acetic acid (CAS: 913528-04-8), wear appropriate personal protective equipment i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...