Compound Q&A

How is DO3AM-acetic acid (CAS: 913528-04-8) typically synthesized?

Answer

DO3AM-acetic acid
DO3AM-acetic acid is synthesized through the acetylation of DO3AM (dodecyl-3-aminomethyl propionic acid) using acetic anhydride in the presence of a catalyst such as pyridine. The reaction is performed under mild conditions, yielding high selectivity and good yield.

About

English Name DO3AM-acetic acid
Molecular Formula C16H31N7O5
Molecular Weight 401.46 g/mol
SMILES C1CN(CCN(CCN(CCN1CC(=O)N)CC(=O)N)CC(=O)O)CC(=O)N
InChIKey DFPHZEYJGWLQJE-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of DO3AM-acetic acid (CAS: 913528-04-8)?

DO3AM-acetic acid (CAS: 913528-04-8) is a white crystalline powder with a molecular weight of approx...

Compound Q&A

What industries use DO3AM-acetic acid (CAS: 913528-04-8)?

DO3AM-acetic acid (CAS: 913528-04-8) is primarily used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling DO3AM-acetic acid (CAS: 913528-04-8)?

When handling DO3AM-acetic acid (CAS: 913528-04-8), wear appropriate personal protective equipment i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...