Compound Q&A

What are the physical and chemical properties of (E)-N-(4-Amino-1-hydroxybutylidene)-L-histidine (CAS: 3650-73-5)?

Answer

(E)-N-(4-Amino-1-hydroxybutylidene)-L-histidine
(E)-N-(4-Amino-1-hydroxybutylidene)-L-histidine is a white to off-white crystalline powder with a molecular weight of approximately 287.38 g/mol. It has a slight solubility in water and is less soluble in organic solvents. This compound is relatively stable under normal conditions but may react with strong acids or bases. It is not flammable and has a high melting point, making it suitable for various applications in chemistry and pharmaceuticals.

About

CAS No 3650-73-5
English Name (E)-N-(4-Amino-1-hydroxybutylidene)-L-histidine
Molecular Formula C10H16N4O3
Molecular Weight 240.26 g/mol
SMILES C1=C(NC=N1)CC(C(=O)O)NC(=O)CCCN
InChIKey CCLQKVKJOGVQLU-QMMMGPOBSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

How is (E)-N-(4-Amino-1-hydroxybutylidene)-L-histidine (CAS: 3650-73-5) typically synthesized?

(E)-N-(4-Amino-1-hydroxybutylidene)-L-histidine can be synthesized by a multi-step process involving...

Compound Q&A

What industries use (E)-N-(4-Amino-1-hydroxybutylidene)-L-histidine (CAS: 3650-73-5)?

(E)-N-(4-Amino-1-hydroxybutylidene)-L-histidine finds applications in various industries, particular...

Compound Q&A

What precautions should be taken when handling (E)-N-(4-Amino-1-hydroxybutylidene)-L-histidine (CAS: 3650-73-5)?

When handling (E)-N-(4-Amino-1-hydroxybutylidene)-L-histidine, it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...