Compound Q&A

What precautions should be taken when handling 2-[2,2-Diphenyl(2-propyn-1-yloxy)acetoxy]-N,N-dimethylethanaminium chloride (CAS: 2765-97-1)?

Answer

2-[2,2-Diphenyl(2-propyn-1-yloxy)acetoxy]-N,N-dimethylethanaminium chloride
Handle the compound with appropriate personal protective equipment (PPE) such as gloves and goggles. It should be stored in a fume hood to minimize exposure. In case of a spill, immediately clean up with the appropriate absorbent material and dispose of in accordance with safety data sheet (SDS) guidelines. Ensure proper ventilation and avoid inhalation or contact with eyes and skin.

About

CAS No 2765-97-1
English Name 2-[2,2-Diphenyl(2-propyn-1-yloxy)acetoxy]-N,N-dimethylethanaminium chloride
Molecular Formula C21H24ClNO3
Molecular Weight 373.9 g/mol
SMILES CN(C)CCOC(=O)C(C1=CC=CC=C1)(C2=CC=CC=C2)OCC#C.Cl
InChIKey RSBGQTFIHFGTSY-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[2,2-Diphenyl(2-propyn-1-yloxy)acetoxy]-N,N-dimethylethanaminium chloride (CAS: 2765-97-1)?

The compound has a crystalline form. Its molecular weight is approximately 612.39 g/mol. It is spari...

Compound Q&A

How is 2-[2,2-Diphenyl(2-propyn-1-yloxy)acetoxy]-N,N-dimethylethanaminium chloride (CAS: 2765-97-1) typically synthesized?

The compound can be synthesized using a multi-step procedure involving acetylation, esterification, ...

Compound Q&A

What industries use 2-[2,2-Diphenyl(2-propyn-1-yloxy)acetoxy]-N,N-dimethylethanaminium chloride (CAS: 2765-97-1)?

This compound is used in the pharmaceutical industry for its potential as a drug candidate. It may a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...