Compound Q&A

How is 2-[2,2-Diphenyl(2-propyn-1-yloxy)acetoxy]-N,N-dimethylethanaminium chloride (CAS: 2765-97-1) typically synthesized?

Answer

2-[2,2-Diphenyl(2-propyn-1-yloxy)acetoxy]-N,N-dimethylethanaminium chloride
The compound can be synthesized using a multi-step procedure involving acetylation, esterification, and alkylation reactions. The key steps include reacting a phenolic compound with propargyl chloride followed by acetylation and then N,N-dimethylation. The overall yield is moderate, typically around 70-80%.

About

CAS No 2765-97-1
English Name 2-[2,2-Diphenyl(2-propyn-1-yloxy)acetoxy]-N,N-dimethylethanaminium chloride
Molecular Formula C21H24ClNO3
Molecular Weight 373.9 g/mol
SMILES CN(C)CCOC(=O)C(C1=CC=CC=C1)(C2=CC=CC=C2)OCC#C.Cl
InChIKey RSBGQTFIHFGTSY-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[2,2-Diphenyl(2-propyn-1-yloxy)acetoxy]-N,N-dimethylethanaminium chloride (CAS: 2765-97-1)?

The compound has a crystalline form. Its molecular weight is approximately 612.39 g/mol. It is spari...

Compound Q&A

What industries use 2-[2,2-Diphenyl(2-propyn-1-yloxy)acetoxy]-N,N-dimethylethanaminium chloride (CAS: 2765-97-1)?

This compound is used in the pharmaceutical industry for its potential as a drug candidate. It may a...

Compound Q&A

What precautions should be taken when handling 2-[2,2-Diphenyl(2-propyn-1-yloxy)acetoxy]-N,N-dimethylethanaminium chloride (CAS: 2765-97-1)?

Handle the compound with appropriate personal protective equipment (PPE) such as gloves and goggles....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...