Compound Q&A

What industries use 2-Amino-1-(3-fluorophenyl)ethanone hydrochloride (CAS: 93102-97-7)?

Answer

2-Amino-1-(3-fluorophenyl)ethanone hydrochloride (1:1)
2-Amino-1-(3-fluorophenyl)ethanone hydrochloride is used in the pharmaceutical industry for the synthesis of drugs with specific pharmacological activities. It is also employed in the development of sensors and semiconductors due to its functional groups, which can be utilized in various applications requiring specific reactivity and solubility.

About

CAS No 93102-97-7
English Name 2-Amino-1-(3-fluorophenyl)ethanone hydrochloride (1:1)
Molecular Formula C8H9ClFNO
Molecular Weight 189.62 g/mol
SMILES C1=CC(=CC(=C1)F)C(=O)CN.Cl
InChIKey XMPKWGFAPGELLM-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-1-(3-fluorophenyl)ethanone hydrochloride (CAS: 93102-97-7)?

2-Amino-1-(3-fluorophenyl)ethanone hydrochloride has a crystalline form with a molecular weight of a...

Compound Q&A

How is 2-Amino-1-(3-fluorophenyl)ethanone hydrochloride (CAS: 93102-97-7) typically synthesized?

2-Amino-1-(3-fluorophenyl)ethanone hydrochloride is typically synthesized via a multi-step process i...

Compound Q&A

What precautions should be taken when handling 2-Amino-1-(3-fluorophenyl)ethanone hydrochloride (CAS: 93102-97-7)?

When handling 2-Amino-1-(3-fluorophenyl)ethanone hydrochloride, it is crucial to use personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...