Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 874140-63-3)?

Answer

2-Methyl-2-propanyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (1:1)
Handling should be done in a well-ventilated area, preferably in a fume hood. Protective equipment such as gloves, goggles, and lab coats is required. Spills should be cleaned up immediately using appropriate materials, and the substance should be stored in a cool, dry place, away from direct sunlight and heat sources. Always refer to the SDS for specific safety guidelines and emergency procedures.

About

English Name 2-Methyl-2-propanyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (1:1)
Molecular Formula C9H19ClN2O2
Molecular Weight 222.72 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C1)N.Cl
InChIKey NBQHLWCRRNDFIY-FJXQXJEOSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 874140-63-3)?

The compound is a crystalline solid with a molecular weight of approximately 269.87 g/mol. It has a ...

Compound Q&A

How is 2-Methyl-2-propanyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 874140-63-3) typically synthesized?

It is typically synthesized through a multistep process involving the formation of a pyrrolidine rin...

Compound Q&A

What industries use 2-Methyl-2-propanyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 874140-63-3)?

This compound is used primarily in the pharmaceutical industry as an intermediate in the synthesis o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...