Compound Q&A

What industries use 2-Methyl-2-propanyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 874140-63-3)?

Answer

2-Methyl-2-propanyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (1:1)
This compound is used primarily in the pharmaceutical industry as an intermediate in the synthesis of complex organic molecules. It also finds applications in the polymer industry, where it can be used as a monomer or in the development of new materials. Additionally, it is explored for use in sensor and semiconductor technologies.

About

English Name 2-Methyl-2-propanyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (1:1)
Molecular Formula C9H19ClN2O2
Molecular Weight 222.72 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C1)N.Cl
InChIKey NBQHLWCRRNDFIY-FJXQXJEOSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 874140-63-3)?

The compound is a crystalline solid with a molecular weight of approximately 269.87 g/mol. It has a ...

Compound Q&A

How is 2-Methyl-2-propanyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 874140-63-3) typically synthesized?

It is typically synthesized through a multistep process involving the formation of a pyrrolidine rin...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 874140-63-3)?

Handling should be done in a well-ventilated area, preferably in a fume hood. Protective equipment s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...