Compound Q&A

How is [3-Methyl-5-(trifluoromethyl)phenyl]boronic acid (CAS: 850411-13-1) typically synthesized?

Answer

[3-Methyl-5-(trifluoromethyl)phenyl]boronic acid
[3-Methyl-5-(trifluoromethyl)phenyl]boronic acid (CAS: 850411-13-1) is commonly synthesized via the Grignard reaction followed by the boronation of the phenolic ring. The process involves reacting a Grignard reagent with 3-methyl-5-(trifluoromethyl)benzaldehyde in an ether solvent, followed by treatment with boron tribromide or boron triiodide to generate the boronic acid derivative.

About

English Name [3-Methyl-5-(trifluoromethyl)phenyl]boronic acid
Molecular Formula C8H8BF3O2
Molecular Weight 203.96 g/mol
SMILES Cc1cc(cc(c1)C(F)(F)F)B(O)O
InChIKey ZZLZUGHSZSVQMK-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-Methyl-5-(trifluoromethyl)phenyl]boronic acid (CAS: 850411-13-1)?

[3-Methyl-5-(trifluoromethyl)phenyl]boronic acid (CAS: 850411-13-1) is a crystalline solid with a mo...

Compound Q&A

What industries use [3-Methyl-5-(trifluoromethyl)phenyl]boronic acid (CAS: 850411-13-1)?

[3-Methyl-5-(trifluoromethyl)phenyl]boronic acid (CAS: 850411-13-1) finds applications in the pharma...

Compound Q&A

What precautions should be taken when handling [3-Methyl-5-(trifluoromethyl)phenyl]boronic acid (CAS: 850411-13-1)?

When handling [3-Methyl-5-(trifluoromethyl)phenyl]boronic acid (CAS: 850411-13-1), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...