Compound Q&A

What industries use Band 3 Protein (824-829) (human) (CAS: 158475-15-1)?

Answer

Band 3 Protein (824-829) (human)
Band 3 Protein (824-829) is primarily used in the pharmaceutical and biotechnology industries for research and drug development. It is also employed in the development of diagnostic kits and in the manufacture of biosensors for detecting various biological markers.

About

English Name Band 3 Protein (824-829) (human)
Molecular Formula C37H65N11O8
Molecular Weight 792 g/mol
SMILES CC(C)C(C(=O)NC(CCCCN)C(=O)O)NC(=O)C(CCCN=C(N)N)NC(=O)C(CCCCN)NC(=O)C(C(C)C)NC(=O)C(CC1=CC=C(C=C1)O)N
InChIKey FDZHWEVWEDGAGN-WPMUBMLPSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Band 3 Protein (824-829) (human) (CAS: 158475-15-1)?

Band 3 Protein (824-829) (human) is a human protein with a molecular weight of approximately 31 kDa....

Compound Q&A

How is Band 3 Protein (824-829) (human) (CAS: 158475-15-1) typically synthesized?

Band 3 Protein (824-829) is synthesized through recombinant DNA technology. The gene encoding the pr...

Compound Q&A

What precautions should be taken when handling Band 3 Protein (824-829) (human) (CAS: 158475-15-1)?

When handling Band 3 Protein (824-829), it is essential to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...