Compound Q&A

How is Band 3 Protein (824-829) (human) (CAS: 158475-15-1) typically synthesized?

Answer

Band 3 Protein (824-829) (human)
Band 3 Protein (824-829) is synthesized through recombinant DNA technology. The gene encoding the protein is cloned into an expression vector, which is then introduced into host cells like E. coli or mammalian cells. The protein is harvested, purified, and often modified to achieve the desired functional form.

About

English Name Band 3 Protein (824-829) (human)
Molecular Formula C37H65N11O8
Molecular Weight 792 g/mol
SMILES CC(C)C(C(=O)NC(CCCCN)C(=O)O)NC(=O)C(CCCN=C(N)N)NC(=O)C(CCCCN)NC(=O)C(C(C)C)NC(=O)C(CC1=CC=C(C=C1)O)N
InChIKey FDZHWEVWEDGAGN-WPMUBMLPSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Band 3 Protein (824-829) (human) (CAS: 158475-15-1)?

Band 3 Protein (824-829) (human) is a human protein with a molecular weight of approximately 31 kDa....

Compound Q&A

What industries use Band 3 Protein (824-829) (human) (CAS: 158475-15-1)?

Band 3 Protein (824-829) is primarily used in the pharmaceutical and biotechnology industries for re...

Compound Q&A

What precautions should be taken when handling Band 3 Protein (824-829) (human) (CAS: 158475-15-1)?

When handling Band 3 Protein (824-829), it is essential to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...