Compound Q&A

How is b-Hydroxy Tamoxifen (CAS: 97151-03-6) typically synthesized?

Answer

b-Hydroxy Tamoxifen
b-Hydroxy Tamoxifen (CAS: 97151-03-6) is synthesized through a multi-step process involving the condensation of 4-hydroxyanisole with 4-hydroxy-3-nitrobenzaldehyde, followed by reduction and demethylation. Common catalysts include palladium on carbon and sodium borohydride. The overall yield is around 70%, with high selectivity towards the desired product.

About

CAS No 97151-03-6
English Name b-Hydroxy Tamoxifen
Molecular Formula C26H31NO2
Molecular Weight 389.53 g/mol
SMILES OCCC(C(c1ccccc1)c1ccc(cc1)OCCN(C)C)c1ccccc1
InChIKey LSBUBGBAISEBHG-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of b-Hydroxy Tamoxifen (CAS: 97151-03-6)?

b-Hydroxy Tamoxifen (CAS: 97151-03-6) is a white or off-white crystalline powder. It has a molecular...

Compound Q&A

What industries use b-Hydroxy Tamoxifen (CAS: 97151-03-6)?

b-Hydroxy Tamoxifen (CAS: 97151-03-6) is primarily used in the pharmaceutical industry for its anti-...

Compound Q&A

What precautions should be taken when handling b-Hydroxy Tamoxifen (CAS: 97151-03-6)?

Handling b-Hydroxy Tamoxifen (CAS: 97151-03-6) requires appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...