Compound Q&A

What industries use 5-(4-Methylphenyl)-5-oxopentanoic acid (CAS: 833-85-2)?

Answer

5-(4-Methylphenyl)-5-oxopentanoic acid
5-(4-Methylphenyl)-5-oxopentanoic acid (CAS: 833-85-2) is used in various industries, including pharmaceuticals for drug synthesis, polymers for monomer applications, and sensors for detection of specific chemicals. Its use in semiconductors is also explored for its potential in organic electronic devices.

About

CAS No 833-85-2
English Name 5-(4-Methylphenyl)-5-oxopentanoic acid
Molecular Formula C12H14O3
Molecular Weight 206.24 g/mol
SMILES CC1=CC=C(C=C1)C(=O)CCCC(=O)O
InChIKey MCWLCBLXRSXGTF-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(4-Methylphenyl)-5-oxopentanoic acid (CAS: 833-85-2)?

5-(4-Methylphenyl)-5-oxopentanoic acid (CAS: 833-85-2) is a white crystalline solid with a molecular...

Compound Q&A

How is 5-(4-Methylphenyl)-5-oxopentanoic acid (CAS: 833-85-2) typically synthesized?

5-(4-Methylphenyl)-5-oxopentanoic acid (CAS: 833-85-2) is typically synthesized via the condensation...

Compound Q&A

What precautions should be taken when handling 5-(4-Methylphenyl)-5-oxopentanoic acid (CAS: 833-85-2)?

When handling 5-(4-Methylphenyl)-5-oxopentanoic acid (CAS: 833-85-2), it is important to wear person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...