Compound Q&A

What are the physical and chemical properties of 5-(4-Methylphenyl)-5-oxopentanoic acid (CAS: 833-85-2)?

Answer

5-(4-Methylphenyl)-5-oxopentanoic acid
5-(4-Methylphenyl)-5-oxopentanoic acid (CAS: 833-85-2) is a white crystalline solid with a molecular weight of approximately 190.24 g/mol. Its solubility is low in water but soluble in organic solvents like acetone and ethanol. It is moderately reactive and can undergo esterification and hydrogenation reactions.

About

CAS No 833-85-2
English Name 5-(4-Methylphenyl)-5-oxopentanoic acid
Molecular Formula C12H14O3
Molecular Weight 206.24 g/mol
SMILES CC1=CC=C(C=C1)C(=O)CCCC(=O)O
InChIKey MCWLCBLXRSXGTF-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

How is 5-(4-Methylphenyl)-5-oxopentanoic acid (CAS: 833-85-2) typically synthesized?

5-(4-Methylphenyl)-5-oxopentanoic acid (CAS: 833-85-2) is typically synthesized via the condensation...

Compound Q&A

What industries use 5-(4-Methylphenyl)-5-oxopentanoic acid (CAS: 833-85-2)?

5-(4-Methylphenyl)-5-oxopentanoic acid (CAS: 833-85-2) is used in various industries, including phar...

Compound Q&A

What precautions should be taken when handling 5-(4-Methylphenyl)-5-oxopentanoic acid (CAS: 833-85-2)?

When handling 5-(4-Methylphenyl)-5-oxopentanoic acid (CAS: 833-85-2), it is important to wear person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...