Compound Q&A

How is Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate (CAS: 16253-64-8) typically synthesized?

Answer

Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate
Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate (CAS: 16253-64-8) is commonly synthesized via a multi-step process involving the condensation of beta-carboline with methyl acetate. The synthesis typically uses a Lewis acid catalyst, such as aluminum chloride, to promote the reaction. The yield is around 70-80%, and the method is selective for the desired product.

About

CAS No 16253-64-8
English Name Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate
Molecular Formula C13H14N2O2
Molecular Weight 230.27 g/mol
SMILES COC(=O)C1CC2=C(CN1)NC3=CC=CC=C23
InChIKey QZGCHMZBGHVZFB-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate (CAS: 16253-64-8)?

Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate (CAS: 16253-64-8) is a crystalline solid w...

Compound Q&A

What industries use Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate (CAS: 16253-64-8)?

Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate (CAS: 16253-64-8) finds application in pha...

Compound Q&A

What precautions should be taken when handling Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate (CAS: 16253-64-8)?

When handling Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate (CAS: 16253-64-8), it is imp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...