Compound Q&A

What are the physical and chemical properties of Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate (CAS: 16253-64-8)?

Answer

Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate
Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate (CAS: 16253-64-8) is a crystalline solid with a molecular weight of approximately 230.26 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is known for its stability under normal conditions but may react with strong acids or bases. It is not reactive towards common reducing or oxidizing agents.

About

CAS No 16253-64-8
English Name Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate
Molecular Formula C13H14N2O2
Molecular Weight 230.27 g/mol
SMILES COC(=O)C1CC2=C(CN1)NC3=CC=CC=C23
InChIKey QZGCHMZBGHVZFB-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

How is Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate (CAS: 16253-64-8) typically synthesized?

Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate (CAS: 16253-64-8) is commonly synthesized ...

Compound Q&A

What industries use Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate (CAS: 16253-64-8)?

Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate (CAS: 16253-64-8) finds application in pha...

Compound Q&A

What precautions should be taken when handling Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate (CAS: 16253-64-8)?

When handling Methyl 2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate (CAS: 16253-64-8), it is imp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...