Compound Q&A

How should (2E)-3-{2-[(4-Chlorophenyl)sulfanyl]phenyl}-N-[4-(dimethylamino)butyl]acrylamide hydrochloride (CAS: 1217201-17-6) be stored?

Answer

(2E)-3-{2-[(4-Chlorophenyl)sulfanyl]phenyl}-N-[4-(dimethylamino)butyl]acrylamide hydrochloride (1:1)
This compound should be stored in a cool, dry place, protected from light and heat. It should be kept in a tightly sealed container to prevent degradation. It is crucial to maintain stable conditions to ensure its quality and safety during storage.

About

English Name (2E)-3-{2-[(4-Chlorophenyl)sulfanyl]phenyl}-N-[4-(dimethylamino)butyl]acrylamide hydrochloride (1:1)
Molecular Formula C21H26Cl2N2OS
Molecular Weight 425.43 g/mol
SMILES CN(CCCCNC(=O)/C=C/c1ccccc1Sc1ccc(cc1)Cl)C.Cl
InChIKey PDVBHWZPRQFKJS-KYIGKLDSSA-N
Last Updated: 2026-03-16 04:59

Related Q&A

Compound Q&A

What is (2E)-3-{2-[(4-Chlorophenyl)sulfanyl]phenyl}-N-[4-(dimethylamino)butyl]acrylamide hydrochloride (CAS: 1217201-17-6)?

It is a hydrochloride salt of a specific acrylamide derivative with a unique molecular structure. Th...

Compound Q&A

What are the main uses of (2E)-3-{2-[(4-Chlorophenyl)sulfanyl]phenyl}-N-[4-(dimethylamino)butyl]acrylamide hydrochloride (CAS: 1217201-17-6)?

This compound is primarily used in the development of potential therapeutic agents. It serves as a k...

Compound Q&A

Is (2E)-3-{2-[(4-Chlorophenyl)sulfanyl]phenyl}-N-[4-(dimethylamino)butyl]acrylamide hydrochloride (CAS: 1217201-17-6) safe?

The safety of this compound depends on the conditions of use and exposure. It is generally safe when...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...