Compound Q&A

Is (2E)-3-{2-[(4-Chlorophenyl)sulfanyl]phenyl}-N-[4-(dimethylamino)butyl]acrylamide hydrochloride (CAS: 1217201-17-6) safe?

Answer

(2E)-3-{2-[(4-Chlorophenyl)sulfanyl]phenyl}-N-[4-(dimethylamino)butyl]acrylamide hydrochloride (1:1)
The safety of this compound depends on the conditions of use and exposure. It is generally safe when handled with proper personal protective equipment and following standard laboratory protocols. However, it should be stored away from direct sunlight and heat to minimize the risk of degradation.

About

English Name (2E)-3-{2-[(4-Chlorophenyl)sulfanyl]phenyl}-N-[4-(dimethylamino)butyl]acrylamide hydrochloride (1:1)
Molecular Formula C21H26Cl2N2OS
Molecular Weight 425.43 g/mol
SMILES CN(CCCCNC(=O)/C=C/c1ccccc1Sc1ccc(cc1)Cl)C.Cl
InChIKey PDVBHWZPRQFKJS-KYIGKLDSSA-N
Last Updated: 2026-03-16 04:59

Related Q&A

Compound Q&A

What is (2E)-3-{2-[(4-Chlorophenyl)sulfanyl]phenyl}-N-[4-(dimethylamino)butyl]acrylamide hydrochloride (CAS: 1217201-17-6)?

It is a hydrochloride salt of a specific acrylamide derivative with a unique molecular structure. Th...

Compound Q&A

What are the main uses of (2E)-3-{2-[(4-Chlorophenyl)sulfanyl]phenyl}-N-[4-(dimethylamino)butyl]acrylamide hydrochloride (CAS: 1217201-17-6)?

This compound is primarily used in the development of potential therapeutic agents. It serves as a k...

Compound Q&A

How should (2E)-3-{2-[(4-Chlorophenyl)sulfanyl]phenyl}-N-[4-(dimethylamino)butyl]acrylamide hydrochloride (CAS: 1217201-17-6) be stored?

This compound should be stored in a cool, dry place, protected from light and heat. It should be kep...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...