Compound Q&A

Is 3-(N-Methylglycyl)phenyl hydrogen sulfate (CAS: 679394-62-8) safe?

Answer

3-(N-Methylglycyl)phenyl hydrogen sulfate
3-(N-Methylglycyl)phenyl hydrogen sulfate is generally considered safe under normal handling conditions. However, it is important to follow safety guidelines, including wearing appropriate personal protective equipment (PPE) such as gloves and goggles, and storing it in a well-ventilated area to avoid inhaling fumes. Ensure proper disposal and avoid contact with eyes and skin.

About

English Name 3-(N-Methylglycyl)phenyl hydrogen sulfate
Molecular Formula C9H11NO5S
Molecular Weight 245.26 g/mol
SMILES CNCC(=O)C1=CC(=CC=C1)O.OS(=O)(=O)O
InChIKey MTKSUICAZQREKI-UHFFFAOYSA-N
Last Updated: 2026-03-16 04:59

Related Q&A

Compound Q&A

What is 3-(N-Methylglycyl)phenyl hydrogen sulfate (CAS: 679394-62-8)?

3-(N-Methylglycyl)phenyl hydrogen sulfate is a chemical compound with the CAS number 679394-62-8. It...

Compound Q&A

What are the main uses of 3-(N-Methylglycyl)phenyl hydrogen sulfate (CAS: 679394-62-8)?

3-(N-Methylglycyl)phenyl hydrogen sulfate is primarily used as a reagent in chemical synthesis, part...

Compound Q&A

How should 3-(N-Methylglycyl)phenyl hydrogen sulfate (CAS: 679394-62-8) be stored?

3-(N-Methylglycyl)phenyl hydrogen sulfate should be stored in a cool, dry place, away from direct su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...