Compound Q&A

What are the main uses of 3-(N-Methylglycyl)phenyl hydrogen sulfate (CAS: 679394-62-8)?

Answer

3-(N-Methylglycyl)phenyl hydrogen sulfate
3-(N-Methylglycyl)phenyl hydrogen sulfate is primarily used as a reagent in chemical synthesis, particularly in organic synthesis and analytical chemistry. It also finds applications in pharmaceuticals for intermediate synthesis and in the food industry as a flavoring agent.

About

English Name 3-(N-Methylglycyl)phenyl hydrogen sulfate
Molecular Formula C9H11NO5S
Molecular Weight 245.26 g/mol
SMILES CNCC(=O)C1=CC(=CC=C1)O.OS(=O)(=O)O
InChIKey MTKSUICAZQREKI-UHFFFAOYSA-N
Last Updated: 2026-03-16 04:59

Related Q&A

Compound Q&A

What is 3-(N-Methylglycyl)phenyl hydrogen sulfate (CAS: 679394-62-8)?

3-(N-Methylglycyl)phenyl hydrogen sulfate is a chemical compound with the CAS number 679394-62-8. It...

Compound Q&A

Is 3-(N-Methylglycyl)phenyl hydrogen sulfate (CAS: 679394-62-8) safe?

3-(N-Methylglycyl)phenyl hydrogen sulfate is generally considered safe under normal handling conditi...

Compound Q&A

How should 3-(N-Methylglycyl)phenyl hydrogen sulfate (CAS: 679394-62-8) be stored?

3-(N-Methylglycyl)phenyl hydrogen sulfate should be stored in a cool, dry place, away from direct su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...