Compound Q&A

Is 2-Methyl-8-quinolinesulfonic acid (CAS: 146257-38-7) safe?

Answer

2-Methyl-8-quinolinesulfonic acid
2-Methyl-8-quinolinesulfonic acid (CAS: 146257-38-7) is generally safe when handled properly. However, it should be used in a well-ventilated area and with appropriate personal protective equipment (PPE) such as gloves and goggles to prevent skin and eye contact. Ingestion or inhalation of dust should be avoided.

About

English Name 2-Methyl-8-quinolinesulfonic acid
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES CC1=NC2=C(C=CC=C2S(=O)(=O)O)C=C1
InChIKey ZSBMDUMZTUVHRL-UHFFFAOYSA-N
Last Updated: 2026-03-15 17:49

Related Q&A

Compound Q&A

What is 2-Methyl-8-quinolinesulfonic acid (CAS: 146257-38-7)?

2-Methyl-8-quinolinesulfonic acid (CAS: 146257-38-7) is a chemical compound with a molecular formula...

Compound Q&A

What are the main uses of 2-Methyl-8-quinolinesulfonic acid (CAS: 146257-38-7)?

2-Methyl-8-quinolinesulfonic acid is primarily used as an intermediate in the synthesis of other che...

Compound Q&A

How should 2-Methyl-8-quinolinesulfonic acid (CAS: 146257-38-7) be stored?

2-Methyl-8-quinolinesulfonic acid (CAS: 146257-38-7) should be stored in a cool, dry place away from...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...