Compound Q&A

What is 2-Methyl-8-quinolinesulfonic acid (CAS: 146257-38-7)?

Answer

2-Methyl-8-quinolinesulfonic acid
2-Methyl-8-quinolinesulfonic acid (CAS: 146257-38-7) is a chemical compound with a molecular formula C11H9NO3S. It is a derivative of quinolinesulfonic acid with a methyl substitution at the 8-position. This compound is highly polar and has good solubility in water and organic solvents.

About

English Name 2-Methyl-8-quinolinesulfonic acid
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES CC1=NC2=C(C=CC=C2S(=O)(=O)O)C=C1
InChIKey ZSBMDUMZTUVHRL-UHFFFAOYSA-N
Last Updated: 2026-03-15 17:49

Related Q&A

Compound Q&A

What are the main uses of 2-Methyl-8-quinolinesulfonic acid (CAS: 146257-38-7)?

2-Methyl-8-quinolinesulfonic acid is primarily used as an intermediate in the synthesis of other che...

Compound Q&A

Is 2-Methyl-8-quinolinesulfonic acid (CAS: 146257-38-7) safe?

2-Methyl-8-quinolinesulfonic acid (CAS: 146257-38-7) is generally safe when handled properly. Howeve...

Compound Q&A

How should 2-Methyl-8-quinolinesulfonic acid (CAS: 146257-38-7) be stored?

2-Methyl-8-quinolinesulfonic acid (CAS: 146257-38-7) should be stored in a cool, dry place away from...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...