Compound Q&A

What are the main uses of Ampicillin impurity F (CAS: 124774-48-7)?

Answer

Ampicillin impurity F
Ampicillin impurity F (CAS: 124774-48-7) is not used directly in medical or industrial applications. It is primarily detected and controlled during the quality assurance process of ampicillin to ensure the drug meets regulatory standards. Its presence is indicative of the quality and stability of ampicillin formulations.

About

English Name Ampicillin impurity F
Molecular Formula C15H21N3O3S
Molecular Weight 323.41 g/mol
SMILES CC1(C(NC(S1)CNC(=O)C(C2=CC=CC=C2)N)C(=O)O)C
InChIKey PIIGZYMBHCDKIJ-SDDRHHMPSA-N
Last Updated: 2026-03-15 14:11

Related Q&A

Compound Q&A

What is Ampicillin impurity F (CAS: 124774-48-7)?

Ampicillin impurity F (CAS: 124774-48-7) is a specific impurity found in the drug ampicillin, a broa...

Compound Q&A

Is Ampicillin impurity F (CAS: 124774-48-7) safe?

Ampicillin impurity F (CAS: 124774-48-7) is generally considered safe in trace amounts as part of am...

Compound Q&A

How should Ampicillin impurity F (CAS: 124774-48-7) be stored?

Ampicillin impurity F (CAS: 124774-48-7) should be stored in a cool, dry place, away from direct sun...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...