Compound Q&A

What is Ampicillin impurity F (CAS: 124774-48-7)?

Answer

Ampicillin impurity F
Ampicillin impurity F (CAS: 124774-48-7) is a specific impurity found in the drug ampicillin, a broad-spectrum penicillin antibiotic. It typically consists of degradation products that arise during manufacturing or storage of ampicillin. It has a molecular weight of approximately 349.4 g/mol and is characterized by its amphoteric nature, meaning it can act as both an acid and a base.

About

English Name Ampicillin impurity F
Molecular Formula C15H21N3O3S
Molecular Weight 323.41 g/mol
SMILES CC1(C(NC(S1)CNC(=O)C(C2=CC=CC=C2)N)C(=O)O)C
InChIKey PIIGZYMBHCDKIJ-SDDRHHMPSA-N
Last Updated: 2026-03-15 14:11

Related Q&A

Compound Q&A

What are the main uses of Ampicillin impurity F (CAS: 124774-48-7)?

Ampicillin impurity F (CAS: 124774-48-7) is not used directly in medical or industrial applications....

Compound Q&A

Is Ampicillin impurity F (CAS: 124774-48-7) safe?

Ampicillin impurity F (CAS: 124774-48-7) is generally considered safe in trace amounts as part of am...

Compound Q&A

How should Ampicillin impurity F (CAS: 124774-48-7) be stored?

Ampicillin impurity F (CAS: 124774-48-7) should be stored in a cool, dry place, away from direct sun...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...