Compound Q&A

What is the market or research trend for [5-fluoro-2-(morpholine-4-carbonyl)phenyl]boronic acid (CAS: 1217501-26-2)?

Answer

[5-fluoro-2-(morpholine-4-carbonyl)phenyl]boronic acid
The market and research trends for [5-fluoro-2-(morpholine-4-carbonyl)phenyl]boronic acid (CAS: 1217501-26-2) indicate increasing interest in its application in medicinal chemistry and drug synthesis. Emerging research focuses on its role in cancer therapy and as a potential therapeutic agent. Additionally, there is a growing trend towards sustainable and greener chemical synthesis methods.

About

English Name [5-fluoro-2-(morpholine-4-carbonyl)phenyl]boronic acid
Molecular Formula C11H13BFNO4
Molecular Weight 253.03799999999993 g/mol
SMILES Fc1ccc(c(c1)B(O)O)C(=O)N1CCOCC1
InChIKey XSMRDMHBUWMLBL-UHFFFAOYSA-N
Last Updated: 2026-03-15 04:53

Related Q&A

Compound Q&A

What regulatory guidelines apply to [5-fluoro-2-(morpholine-4-carbonyl)phenyl]boronic acid (CAS: 1217501-26-2)?

Regulatory guidelines for [5-fluoro-2-(morpholine-4-carbonyl)phenyl]boronic acid (CAS: 1217501-26-2)...

Compound Q&A

Are there alternatives to [5-fluoro-2-(morpholine-4-carbonyl)phenyl]boronic acid (CAS: 1217501-26-2) in synthesis?

There are several alternatives to [5-fluoro-2-(morpholine-4-carbonyl)phenyl]boronic acid (CAS: 12175...

Compound Q&A

How should waste containing [5-fluoro-2-(morpholine-4-carbonyl)phenyl]boronic acid (CAS: 1217501-26-2) be handled?

Waste containing [5-fluoro-2-(morpholine-4-carbonyl)phenyl]boronic acid (CAS: 1217501-26-2) should b...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...