Compound Q&A

What are the physical and chemical properties of [(2S)-4-Benzyl-2-piperazinyl]methanol (CAS: 149715-45-7)?

Answer

[(2S)-4-Benzyl-2-piperazinyl]methanol
[(2S)-4-Benzyl-2-piperazinyl]methanol (CAS 149715-45-7) is a crystalline solid with a molecular weight of approximately 251.34 g/mol. It has a pKa of around 8.5, indicating basic properties. The compound is slightly soluble in water but more soluble in organic solvents like methanol and ethanol. It is a chiral molecule, and its reactivity is influenced by the presence of the benzyl and piperazine groups, making it useful in various synthetic transformations.

About

English Name [(2S)-4-Benzyl-2-piperazinyl]methanol
Molecular Formula C12H18N2O
Molecular Weight 206.29 g/mol
SMILES C1CN(CC(N1)CO)CC2=CC=CC=C2
InChIKey PJMFGDYBTJEEDP-LBPRGKRZSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

How is [(2S)-4-Benzyl-2-piperazinyl]methanol (CAS: 149715-45-7) typically synthesized?

[(2S)-4-Benzyl-2-piperazinyl]methanol can be synthesized via a multi-step process starting from benz...

Compound Q&A

What industries use [(2S)-4-Benzyl-2-piperazinyl]methanol (CAS: 149715-45-7)?

[(2S)-4-Benzyl-2-piperazinyl]methanol (CAS 149715-45-7) is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling [(2S)-4-Benzyl-2-piperazinyl]methanol (CAS: 149715-45-7)?

When handling [(2S)-4-Benzyl-2-piperazinyl]methanol (CAS 149715-45-7), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...