Compound Q&A

What are the physical and chemical properties of 2-(~2~H_3_)Methyl(~2~H_6_)aniline (CAS: 194423-47-7)?

Answer

2-(~2~H_3_)Methyl(~2~H_6_)aniline
2-(~2~H_3_)Methyl(~2~H_6_)aniline (CAS: 194423-47-7) is a white crystalline solid with a molecular weight of approximately 194.2 g/mol. It is slightly soluble in water but soluble in common organic solvents like ethanol and acetone. Chemically, it is relatively stable but can undergo substitution reactions. It is used as a precursor in the synthesis of various compounds and materials.

About

English Name 2-(~2~H_3_)Methyl(~2~H_6_)aniline
Molecular Formula C7D9N
Molecular Weight 116.21 g/mol
SMILES [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])[2H])N([2H])[2H])[2H])[2H]
InChIKey RNVCVTLRINQCPJ-LLZDZVHOSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

How is 2-(~2~H_3_)Methyl(~2~H_6_)aniline (CAS: 194423-47-7) typically synthesized?

2-(~2~H_3_)Methyl(~2~H_6_)aniline (CAS: 194423-47-7) is typically synthesized via a coupling reactio...

Compound Q&A

What industries use 2-(~2~H_3_)Methyl(~2~H_6_)aniline (CAS: 194423-47-7)?

2-(~2~H_3_)Methyl(~2~H_6_)aniline (CAS: 194423-47-7) is used in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling 2-(~2~H_3_)Methyl(~2~H_6_)aniline (CAS: 194423-47-7)?

When handling 2-(~2~H_3_)Methyl(~2~H_6_)aniline (CAS: 194423-47-7), it is essential to use personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...