Compound Q&A

How is N1-Me-pUTP, 100mM Solution (CAS: 1428903-59-6) typically synthesized?

Answer

N1-Me-pUTP, 100mM Solution
N1-Me-pUTP, 100mM Solution (CAS: 1428903-59-6) is synthesized through the esterification of uridine monophosphate (UMP) with methylamine followed by the addition of a triphosphate group. Commonly, phosphoramidite chemistry is used for the triphosphorylation step. The synthesis typically involves multiple steps, with high yield and selectivity, and the use of appropriate catalysts and reagents.

About

English Name N1-Me-pUTP, 100mM Solution
Molecular Formula C10H17N2O15P3
Molecular Weight 498.17 g/mol
SMILES P(=O)(O[H])(OP(=O)(O[H])OP(=O)(O[H])O[H])OC([H])([H])C1([H])C([H])(C([H])(C([H])(C2C(N([H])C(N(C([H])([H])[H])C=2[H])=O)=O)O1)O[H])O[H]
InChIKey OLRONOIBERDKRE-UHFFFAOYSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of N1-Me-pUTP, 100mM Solution (CAS: 1428903-59-6)?

N1-Me-pUTP, 100mM Solution (CAS: 1428903-59-6) is a nucleoside triphosphate derivative. It has a cry...

Compound Q&A

What industries use N1-Me-pUTP, 100mM Solution (CAS: 1428903-59-6)?

N1-Me-pUTP, 100mM Solution (CAS: 1428903-59-6) is used in the pharmaceutical industry for the develo...

Compound Q&A

What precautions should be taken when handling N1-Me-pUTP, 100mM Solution (CAS: 1428903-59-6)?

When handling N1-Me-pUTP, 100mM Solution (CAS: 1428903-59-6), ensure appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...