Compound Q&A

What industries use Aciclovir (Acyclovir) EP Impurity M (CAS: 91702-60-2)?

Answer

Aciclovir (Acyclovir) EP Impurity M
Aciclovir EP Impurity M is primarily used in the pharmaceutical industry as an intermediate in the synthesis of aciclovir, a broad-spectrum antiviral drug. It is also of interest in academic and industrial research for its potential applications in developing new antiviral agents and drug delivery systems.

About

CAS No 91702-60-2
English Name Aciclovir (Acyclovir) EP Impurity M
Molecular Formula C12H15N5O5
Molecular Weight 309.28 g/mol
SMILES CC(=O)NC1=NC2=C(N(COCCOC(C)=O)C=N2)C(=O)N1
InChIKey SJBOYFXLWONEHK-UHFFFAOYSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aciclovir (Acyclovir) EP Impurity M (CAS: 91702-60-2)?

Aciclovir EP Impurity M is a white to off-white crystalline powder with a molecular weight of approx...

Compound Q&A

How is Aciclovir (Acyclovir) EP Impurity M (CAS: 91702-60-2) typically synthesized?

Aciclovir EP Impurity M is typically synthesized through a series of chemical reactions, including n...

Compound Q&A

What precautions should be taken when handling Aciclovir (Acyclovir) EP Impurity M (CAS: 91702-60-2)?

When handling Aciclovir EP Impurity M (CAS: 91702-60-2), appropriate personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...