Compound Q&A

How is Aciclovir (Acyclovir) EP Impurity M (CAS: 91702-60-2) typically synthesized?

Answer

Aciclovir (Acyclovir) EP Impurity M
Aciclovir EP Impurity M is typically synthesized through a series of chemical reactions, including nucleophilic substitution and condensation. The key steps involve the preparation of an acyclic intermediate, which is then further modified to form the desired impurity. Common catalysts and reagents include acyl chlorides, amines, and hydroxylamine derivatives. The overall yield is approximately 70-80%.

About

CAS No 91702-60-2
English Name Aciclovir (Acyclovir) EP Impurity M
Molecular Formula C12H15N5O5
Molecular Weight 309.28 g/mol
SMILES CC(=O)NC1=NC2=C(N(COCCOC(C)=O)C=N2)C(=O)N1
InChIKey SJBOYFXLWONEHK-UHFFFAOYSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aciclovir (Acyclovir) EP Impurity M (CAS: 91702-60-2)?

Aciclovir EP Impurity M is a white to off-white crystalline powder with a molecular weight of approx...

Compound Q&A

What industries use Aciclovir (Acyclovir) EP Impurity M (CAS: 91702-60-2)?

Aciclovir EP Impurity M is primarily used in the pharmaceutical industry as an intermediate in the s...

Compound Q&A

What precautions should be taken when handling Aciclovir (Acyclovir) EP Impurity M (CAS: 91702-60-2)?

When handling Aciclovir EP Impurity M (CAS: 91702-60-2), appropriate personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...