Compound Q&A

What precautions should be taken when handling 4-n-Propylphenylmagnesium bromide (CAS: 87942-08-3)?

Answer

4-n-Propylphenylmagnesium bromide
4-n-Propylphenylmagnesium bromide should be handled with care due to its high reactivity and potential to form explosive organometallic compounds. Always use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a fume hood to minimize exposure. In case of spill, neutralize with sodium bicarbonate, then clean up according to standard procedures. Always consult the Material Safety Data Sheet (MSDS) for detailed safety information.

About

CAS No 87942-08-3
English Name 4-n-Propylphenylmagnesium bromide
Molecular Formula C9H11BrMg
Molecular Weight 223.39599999999996 g/mol
SMILES CCCC1=CC=[C-]C=C1.[Mg+2].[Br-]
InChIKey HFPDWJMICZDKNO-UHFFFAOYSA-M
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-n-Propylphenylmagnesium bromide (CAS: 87942-08-3)?

4-n-Propylphenylmagnesium bromide is a colorless to pale yellow liquid at room temperature. Its mole...

Compound Q&A

How is 4-n-Propylphenylmagnesium bromide (CAS: 87942-08-3) typically synthesized?

4-n-Propylphenylmagnesium bromide is synthesized by reacting n-propyl bromide with phenyl magnesium ...

Compound Q&A

What industries use 4-n-Propylphenylmagnesium bromide (CAS: 87942-08-3)?

4-n-Propylphenylmagnesium bromide is primarily used in the pharmaceutical and polymer industries for...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...