Compound Q&A

How is 4-n-Propylphenylmagnesium bromide (CAS: 87942-08-3) typically synthesized?

Answer

4-n-Propylphenylmagnesium bromide
4-n-Propylphenylmagnesium bromide is synthesized by reacting n-propyl bromide with phenyl magnesium bromide in an inert solvent such as diethyl ether. The reaction is typically carried out under anhydrous conditions to avoid hydrolysis. The yield is around 70-80%, with high selectivity towards the desired product.

About

CAS No 87942-08-3
English Name 4-n-Propylphenylmagnesium bromide
Molecular Formula C9H11BrMg
Molecular Weight 223.39599999999996 g/mol
SMILES CCCC1=CC=[C-]C=C1.[Mg+2].[Br-]
InChIKey HFPDWJMICZDKNO-UHFFFAOYSA-M
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-n-Propylphenylmagnesium bromide (CAS: 87942-08-3)?

4-n-Propylphenylmagnesium bromide is a colorless to pale yellow liquid at room temperature. Its mole...

Compound Q&A

What industries use 4-n-Propylphenylmagnesium bromide (CAS: 87942-08-3)?

4-n-Propylphenylmagnesium bromide is primarily used in the pharmaceutical and polymer industries for...

Compound Q&A

What precautions should be taken when handling 4-n-Propylphenylmagnesium bromide (CAS: 87942-08-3)?

4-n-Propylphenylmagnesium bromide should be handled with care due to its high reactivity and potenti...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...