Compound Q&A

What are the physical and chemical properties of 4-n-Propylphenylmagnesium bromide (CAS: 87942-08-3)?

Answer

4-n-Propylphenylmagnesium bromide
4-n-Propylphenylmagnesium bromide is a colorless to pale yellow liquid at room temperature. Its molecular weight is approximately 213.25 g/mol. It is moderately soluble in diethyl ether and ethanol but insoluble in water. This compound is highly reactive, especially towards protic solvents and water, making it suitable for Grignard reactions.

About

CAS No 87942-08-3
English Name 4-n-Propylphenylmagnesium bromide
Molecular Formula C9H11BrMg
Molecular Weight 223.39599999999996 g/mol
SMILES CCCC1=CC=[C-]C=C1.[Mg+2].[Br-]
InChIKey HFPDWJMICZDKNO-UHFFFAOYSA-M
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

How is 4-n-Propylphenylmagnesium bromide (CAS: 87942-08-3) typically synthesized?

4-n-Propylphenylmagnesium bromide is synthesized by reacting n-propyl bromide with phenyl magnesium ...

Compound Q&A

What industries use 4-n-Propylphenylmagnesium bromide (CAS: 87942-08-3)?

4-n-Propylphenylmagnesium bromide is primarily used in the pharmaceutical and polymer industries for...

Compound Q&A

What precautions should be taken when handling 4-n-Propylphenylmagnesium bromide (CAS: 87942-08-3)?

4-n-Propylphenylmagnesium bromide should be handled with care due to its high reactivity and potenti...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...