Compound Q&A

What industries use 4-Methoxyphenyl dimethylvinyl silane (CAS: 55153-99-6)?

Answer

4-Methoxyphenyl dimethylvinyl silane
4-Methoxyphenyl dimethylvinyl silane (CAS: 55153-99-6) is used in the pharmaceutical industry for the synthesis of certain pharmaceutical compounds, in semiconductor manufacturing for its use as a masking agent, and in the production of polymers and sensors due to its reactive nature and stability.

About

CAS No 55153-99-6
English Name 4-Methoxyphenyl dimethylvinyl silane
Molecular Formula C11H16OSi
Molecular Weight 192.33 g/mol
SMILES COC1=CC=C(C=C1)[Si](C)(C)C=C
InChIKey XBJPKILXRGIENA-UHFFFAOYSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methoxyphenyl dimethylvinyl silane (CAS: 55153-99-6)?

4-Methoxyphenyl dimethylvinyl silane (CAS: 55153-99-6) is a colorless, viscous liquid with a molecul...

Compound Q&A

How is 4-Methoxyphenyl dimethylvinyl silane (CAS: 55153-99-6) typically synthesized?

4-Methoxyphenyl dimethylvinyl silane is often synthesized via a Grignard reaction where vinyl magnes...

Compound Q&A

What precautions should be taken when handling 4-Methoxyphenyl dimethylvinyl silane (CAS: 55153-99-6)?

When handling 4-Methoxyphenyl dimethylvinyl silane (CAS: 55153-99-6), safety goggles, gloves, and pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...