Compound Q&A

What are the physical and chemical properties of 4-Methoxyphenyl dimethylvinyl silane (CAS: 55153-99-6)?

Answer

4-Methoxyphenyl dimethylvinyl silane
4-Methoxyphenyl dimethylvinyl silane (CAS: 55153-99-6) is a colorless, viscous liquid with a molecular weight of approximately 218.31 g/mol. It has a moderate solubility in common organic solvents like toluene and poor solubility in water. Chemically, it is characterized by its reactivity towards nucleophiles and its stability under normal storage conditions.

About

CAS No 55153-99-6
English Name 4-Methoxyphenyl dimethylvinyl silane
Molecular Formula C11H16OSi
Molecular Weight 192.33 g/mol
SMILES COC1=CC=C(C=C1)[Si](C)(C)C=C
InChIKey XBJPKILXRGIENA-UHFFFAOYSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

How is 4-Methoxyphenyl dimethylvinyl silane (CAS: 55153-99-6) typically synthesized?

4-Methoxyphenyl dimethylvinyl silane is often synthesized via a Grignard reaction where vinyl magnes...

Compound Q&A

What industries use 4-Methoxyphenyl dimethylvinyl silane (CAS: 55153-99-6)?

4-Methoxyphenyl dimethylvinyl silane (CAS: 55153-99-6) is used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 4-Methoxyphenyl dimethylvinyl silane (CAS: 55153-99-6)?

When handling 4-Methoxyphenyl dimethylvinyl silane (CAS: 55153-99-6), safety goggles, gloves, and pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...