Compound Q&A

What industries use 5-Amino-4-oxo-3,4-dihydro-1-phthalazinyl 2-acetamido-2-deoxy-beta-D-glucopyranoside (CAS: 128879-80-1)?

Answer

5-Amino-4-oxo-3,4-dihydro-1-phthalazinyl 2-acetamido-2-deoxy-beta-D-glucopyranoside
This compound is primarily used in the pharmaceutical industry for the synthesis of active pharmaceutical ingredients (APIs). It can also be used in the polymer industry for specific functional additives and in the semiconductor industry for dopants.

About

English Name 5-Amino-4-oxo-3,4-dihydro-1-phthalazinyl 2-acetamido-2-deoxy-beta-D-glucopyranoside
Molecular Formula C16H20N4O7
Molecular Weight 380.36 g/mol
EINECS 1533716-785-6
SMILES CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1Oc2c3cccc(c3c(=O)[nH]n2)N)CO)O)O
InChIKey YLCXXNRWYKEOPP-CSTFGSAOSA-N
Last Updated: 2026-03-11 04:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Amino-4-oxo-3,4-dihydro-1-phthalazinyl 2-acetamido-2-deoxy-beta-D-glucopyranoside (CAS: 128879-80-1)?

The compound has a crystalline form with a molecular weight of approximately 428.43 g/mol. It has a ...

Compound Q&A

How is 5-Amino-4-oxo-3,4-dihydro-1-phthalazinyl 2-acetamido-2-deoxy-beta-D-glucopyranoside (CAS: 128879-80-1) typically synthesized?

The compound is synthesized via a multi-step process involving phthalazinone and acetic anhydride. C...

Compound Q&A

What precautions should be taken when handling 5-Amino-4-oxo-3,4-dihydro-1-phthalazinyl 2-acetamido-2-deoxy-beta-D-glucopyranoside (CAS: 128879-80-1)?

Handle the compound in a fume hood and wear appropriate personal protective equipment (PPE), includi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...