Compound Q&A

What are the physical and chemical properties of 5-Amino-4-oxo-3,4-dihydro-1-phthalazinyl 2-acetamido-2-deoxy-beta-D-glucopyranoside (CAS: 128879-80-1)?

Answer

5-Amino-4-oxo-3,4-dihydro-1-phthalazinyl 2-acetamido-2-deoxy-beta-D-glucopyranoside
The compound has a crystalline form with a molecular weight of approximately 428.43 g/mol. It has a high solubility in water and low reactivity under normal conditions. It is stable in acidic and basic environments but can undergo hydrolysis under extreme conditions.

About

English Name 5-Amino-4-oxo-3,4-dihydro-1-phthalazinyl 2-acetamido-2-deoxy-beta-D-glucopyranoside
Molecular Formula C16H20N4O7
Molecular Weight 380.36 g/mol
EINECS 1533716-785-6
SMILES CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1Oc2c3cccc(c3c(=O)[nH]n2)N)CO)O)O
InChIKey YLCXXNRWYKEOPP-CSTFGSAOSA-N
Last Updated: 2026-03-11 04:00

Related Q&A

Compound Q&A

How is 5-Amino-4-oxo-3,4-dihydro-1-phthalazinyl 2-acetamido-2-deoxy-beta-D-glucopyranoside (CAS: 128879-80-1) typically synthesized?

The compound is synthesized via a multi-step process involving phthalazinone and acetic anhydride. C...

Compound Q&A

What industries use 5-Amino-4-oxo-3,4-dihydro-1-phthalazinyl 2-acetamido-2-deoxy-beta-D-glucopyranoside (CAS: 128879-80-1)?

This compound is primarily used in the pharmaceutical industry for the synthesis of active pharmaceu...

Compound Q&A

What precautions should be taken when handling 5-Amino-4-oxo-3,4-dihydro-1-phthalazinyl 2-acetamido-2-deoxy-beta-D-glucopyranoside (CAS: 128879-80-1)?

Handle the compound in a fume hood and wear appropriate personal protective equipment (PPE), includi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...