Compound Q&A

What industries use 4-Chloro-N-cyclopropyl-3-nitrobenzamide (CAS: 90797-58-3)?

Answer

4-Chloro-N-cyclopropyl-3-nitrobenzamide
4-Chloro-N-cyclopropyl-3-nitrobenzamide is primarily used in the pharmaceutical industry for the synthesis of drug intermediates. It also finds applications in the polymer industry for the development of advanced materials and sensors. Additionally, it can be used in the electronics industry for semiconductor applications due to its unique chemical properties.

About

CAS No 90797-58-3
English Name 4-Chloro-N-cyclopropyl-3-nitrobenzamide
Molecular Formula C10H9ClN2O3
Molecular Weight 240.64 g/mol
SMILES C1CC1NC(=O)C2=CC(=C(C=C2)Cl)[N+](=O)[O-]
InChIKey ZUWRELJOMFUPGP-UHFFFAOYSA-N
Last Updated: 2026-03-11 04:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-N-cyclopropyl-3-nitrobenzamide (CAS: 90797-58-3)?

4-Chloro-N-cyclopropyl-3-nitrobenzamide is a crystalline solid with a molecular weight of approximat...

Compound Q&A

How is 4-Chloro-N-cyclopropyl-3-nitrobenzamide (CAS: 90797-58-3) typically synthesized?

4-Chloro-N-cyclopropyl-3-nitrobenzamide is synthesized through a multi-step process involving nitrat...

Compound Q&A

What precautions should be taken when handling 4-Chloro-N-cyclopropyl-3-nitrobenzamide (CAS: 90797-58-3)?

When handling 4-Chloro-N-cyclopropyl-3-nitrobenzamide, it is important to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...