Compound Q&A

What precautions should be taken when handling Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate (CAS: 78316-09-3)?

Answer

Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate
When handling Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up promptly using appropriate disposal methods. Refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

CAS No 78316-09-3
English Name Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate
Molecular Formula C8H7N3O2
Molecular Weight 177.163 g/mol
SMILES COC(=O)C1=C2C(=NC=C1)N=CN2
InChIKey IEVPXSBGABKEOL-UHFFFAOYSA-N
Last Updated: 2026-03-10 23:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate (CAS: 78316-09-3)?

Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate is a crystalline compound with a molecular weight of ...

Compound Q&A

How is Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate (CAS: 78316-09-3) typically synthesized?

Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate can be synthesized through the reaction of 1H-imidazo...

Compound Q&A

What industries use Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate (CAS: 78316-09-3)?

Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate finds applications in various industries. It is parti...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...