Compound Q&A

How is Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate (CAS: 78316-09-3) typically synthesized?

Answer

Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate
Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate can be synthesized through the reaction of 1H-imidazo[4,5-b]pyridine-7-carboxylic acid with methyl iodide in the presence of a base like sodium hydride. The reaction is typically performed in anhydrous tetrahydrofuran (THF) at room temperature. The yield is usually around 85%, and the product is isolated by recrystallization from ethanol.

About

CAS No 78316-09-3
English Name Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate
Molecular Formula C8H7N3O2
Molecular Weight 177.163 g/mol
SMILES COC(=O)C1=C2C(=NC=C1)N=CN2
InChIKey IEVPXSBGABKEOL-UHFFFAOYSA-N
Last Updated: 2026-03-10 23:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate (CAS: 78316-09-3)?

Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate is a crystalline compound with a molecular weight of ...

Compound Q&A

What industries use Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate (CAS: 78316-09-3)?

Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate finds applications in various industries. It is parti...

Compound Q&A

What precautions should be taken when handling Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate (CAS: 78316-09-3)?

When handling Methyl 1H-imidazo[4,5-b]pyridine-7-carboxylate, it is essential to use appropriate per...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...