Compound Q&A

What are the physical and chemical properties of (5alpha)-17-Butyl-3,14-dihydroxy-4,5-epoxymorphinan-6-one (CAS: 503090-99-1)?

Answer

(5alpha)-17-Butyl-3,14-dihydroxy-4,5-epoxymorphinan-6-one
The compound (5alpha)-17-Butyl-3,14-dihydroxy-4,5-epoxymorphinan-6-one is a crystalline solid with a molecular weight of approximately 365.48 g/mol. It has a low solubility in water but is more soluble in organic solvents such as methanol and ethanol. The compound is known for its epoxide functionality and hydroxyl groups, which make it reactive towards nucleophiles and electrophiles. It is susceptible to hydrolysis under basic conditions.

About

English Name (5alpha)-17-Butyl-3,14-dihydroxy-4,5-epoxymorphinan-6-one
Molecular Formula C20H25NO4
Molecular Weight 343.42 g/mol
SMILES CCCCN1CC[C@@]23[C@H]4OC5C2=C(C[C@@H]1[C@]3(O)CCC4=O)C=CC=5O
InChIKey QTHCSWUOQYHRFK-XFWGSAIBSA-N
Last Updated: 2026-03-10 23:59

Related Q&A

Compound Q&A

How is (5alpha)-17-Butyl-3,14-dihydroxy-4,5-epoxymorphinan-6-one (CAS: 503090-99-1) typically synthesized?

(5alpha)-17-Butyl-3,14-dihydroxy-4,5-epoxymorphinan-6-one can be synthesized via a multi-step proces...

Compound Q&A

What industries use (5alpha)-17-Butyl-3,14-dihydroxy-4,5-epoxymorphinan-6-one (CAS: 503090-99-1)?

(5alpha)-17-Butyl-3,14-dihydroxy-4,5-epoxymorphinan-6-one is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling (5alpha)-17-Butyl-3,14-dihydroxy-4,5-epoxymorphinan-6-one (CAS: 503090-99-1)?

When handling (5alpha)-17-Butyl-3,14-dihydroxy-4,5-epoxymorphinan-6-one, it is important to use pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...