Compound Q&A

What are the physical and chemical properties of 4-Nitro(~2~H_4_)phenol (CAS: 93951-79-2)?

Answer

4-Nitro(~2~H_4_)phenol
4-Nitro(~2~H_4_)phenol, also known as 2-hydroxynitrobenzene, is a crystalline white to pale yellow solid with a molecular weight of approximately 149.05 g/mol. It is slightly soluble in water and soluble in organic solvents. It is a reactive compound due to the presence of the nitro and hydroxyl groups. The compound exhibits acidity and can undergo electrophilic substitution reactions.

About

CAS No 93951-79-2
English Name 4-Nitro(~2~H_4_)phenol
Molecular Formula C6HD4NO3
Molecular Weight 143.13 g/mol
SMILES C1=CC(=CC=C1[N+](=O)[O-])O
InChIKey BTJIUGUIPKRLHP-RHQRLBAQSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

How is 4-Nitro(~2~H_4_)phenol (CAS: 93951-79-2) typically synthesized?

4-Nitro(~2~H_4_)phenol can be synthesized through the nitration of phenol. This process involves the...

Compound Q&A

What industries use 4-Nitro(~2~H_4_)phenol (CAS: 93951-79-2)?

4-Nitro(~2~H_4_)phenol is used in various industries, including pharmaceuticals, where it serves as ...

Compound Q&A

What precautions should be taken when handling 4-Nitro(~2~H_4_)phenol (CAS: 93951-79-2)?

When handling 4-Nitro(~2~H_4_)phenol, appropriate personal protective equipment (PPE) such as gloves...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...