Compound Q&A

How is 3-Hydroxyandrost-1-en-17-one (CAS: 76822-24-7) typically synthesized?

Answer

3-Hydroxyandrost-1-en-17-one
3-Hydroxyandrost-1-en-17-one can be synthesized via a multi-step process starting from androst-1,4-dien-3-one. The synthesis involves reduction of the ketone, followed by hydroxylation, and finally, a series of alkylation reactions. Common catalysts include palladium on carbon and hydrogen for reduction steps. The overall yield is moderate, around 50-70%, depending on the purification and reaction conditions.

About

CAS No 76822-24-7
English Name 3-Hydroxyandrost-1-en-17-one
Molecular Formula C19H28O2
Molecular Weight 288.43 g/mol
SMILES C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4[C@@]3(C=CC(C4)O)C
InChIKey DYMROBVXGSLPAY-OFLQVFCSSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Hydroxyandrost-1-en-17-one (CAS: 76822-24-7)?

3-Hydroxyandrost-1-en-17-one is a steroid compound. It is a white or off-white crystalline solid wit...

Compound Q&A

What industries use 3-Hydroxyandrost-1-en-17-one (CAS: 76822-24-7)?

3-Hydroxyandrost-1-en-17-one is primarily used in the pharmaceutical industry for the synthesis of s...

Compound Q&A

What precautions should be taken when handling 3-Hydroxyandrost-1-en-17-one (CAS: 76822-24-7)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...