Compound Q&A

What are the physical and chemical properties of 3-Hydroxyandrost-1-en-17-one (CAS: 76822-24-7)?

Answer

3-Hydroxyandrost-1-en-17-one
3-Hydroxyandrost-1-en-17-one is a steroid compound. It is a white or off-white crystalline solid with a molecular weight of approximately 324.47 g/mol. The compound is slightly soluble in water and ethanol but more soluble in organic solvents like methanol and acetone. It is known for its reactivity towards nucleophiles and can undergo hydrolysis under basic conditions. It is also prone to oxidation)

About

CAS No 76822-24-7
English Name 3-Hydroxyandrost-1-en-17-one
Molecular Formula C19H28O2
Molecular Weight 288.43 g/mol
SMILES C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4[C@@]3(C=CC(C4)O)C
InChIKey DYMROBVXGSLPAY-OFLQVFCSSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

How is 3-Hydroxyandrost-1-en-17-one (CAS: 76822-24-7) typically synthesized?

3-Hydroxyandrost-1-en-17-one can be synthesized via a multi-step process starting from androst-1,4-d...

Compound Q&A

What industries use 3-Hydroxyandrost-1-en-17-one (CAS: 76822-24-7)?

3-Hydroxyandrost-1-en-17-one is primarily used in the pharmaceutical industry for the synthesis of s...

Compound Q&A

What precautions should be taken when handling 3-Hydroxyandrost-1-en-17-one (CAS: 76822-24-7)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...