Compound Q&A

How is 3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate (CAS: 10482-79-8) typically synthesized?

Answer

3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate
3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate can be synthesized through a Grignard reaction followed by acylation. The process involves the reaction of a Grignard reagent with 3-phenylacrylic acid, followed by addition of a methyl acrylate derivative using a suitable transition metal catalyst to achieve high selectivity and yield. The reaction is typically carried out in an inert solvent like tetrahydrofuran under anhydrous conditions.

About

CAS No 10482-79-8
English Name 3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate
Molecular Formula C19H26O2
Molecular Weight 286.41 g/mol
SMILES CC(CCC=C(C)C)CCOC(=O)C=CC1=CC=CC=C1
InChIKey KMXKQELDKDGFRN-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate (CAS: 10482-79-8)?

3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate (CAS: 10482-79-8) is a colorless liquid with a fruity, fl...

Compound Q&A

What industries use 3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate (CAS: 10482-79-8)?

3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate (CAS: 10482-79-8) is primarily used in the fragrance and ...

Compound Q&A

What precautions should be taken when handling 3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate (CAS: 10482-79-8)?

When handling 3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate (CAS: 10482-79-8), appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...