Compound Q&A

What are the physical and chemical properties of 3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate (CAS: 10482-79-8)?

Answer

3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate
3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate (CAS: 10482-79-8) is a colorless liquid with a fruity, floral odor. It has a molecular weight of approximately 260.32 g/mol and a boiling point of around 245°C. The compound is soluble in organic solvents like ethanol and acetone but is less soluble in water. It is relatively stable in air but can undergo thermal degradation. Reactivity is minimal under normal conditions but caution is advised in high-temperature applications.

About

CAS No 10482-79-8
English Name 3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate
Molecular Formula C19H26O2
Molecular Weight 286.41 g/mol
SMILES CC(CCC=C(C)C)CCOC(=O)C=CC1=CC=CC=C1
InChIKey KMXKQELDKDGFRN-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

How is 3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate (CAS: 10482-79-8) typically synthesized?

3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate can be synthesized through a Grignard reaction followed b...

Compound Q&A

What industries use 3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate (CAS: 10482-79-8)?

3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate (CAS: 10482-79-8) is primarily used in the fragrance and ...

Compound Q&A

What precautions should be taken when handling 3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate (CAS: 10482-79-8)?

When handling 3,7-Dimethyl-6-octen-1-yl 3-phenylacrylate (CAS: 10482-79-8), appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...