Compound Q&A

What industries use 4-(4-Morpholinyl)-2-pyridinecarboxylic acid (CAS: 66933-68-4)?

Answer

4-(4-Morpholinyl)-2-pyridinecarboxylic acid
4-(4-Morpholinyl)-2-pyridinecarboxylic acid finds applications in the pharmaceutical industry as an intermediate in the synthesis of drugs. It is also used in the development of sensors and semiconductors due to its unique chemical properties. Additionally, it may be utilized in the polymer industry for the development of functional polymers.

About

CAS No 66933-68-4
English Name 4-(4-Morpholinyl)-2-pyridinecarboxylic acid
Molecular Formula C10H12N2O3
Molecular Weight 208.21699999999993 g/mol
SMILES C1COCCN1C2=CC(=NC=C2)C(=O)O
InChIKey WNGUXTKNKZIMJC-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Morpholinyl)-2-pyridinecarboxylic acid (CAS: 66933-68-4)?

4-(4-Morpholinyl)-2-pyridinecarboxylic acid is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 4-(4-Morpholinyl)-2-pyridinecarboxylic acid (CAS: 66933-68-4) typically synthesized?

4-(4-Morpholinyl)-2-pyridinecarboxylic acid is commonly synthesized via the reaction of 4-morpholino...

Compound Q&A

What precautions should be taken when handling 4-(4-Morpholinyl)-2-pyridinecarboxylic acid (CAS: 66933-68-4)?

When handling 4-(4-Morpholinyl)-2-pyridinecarboxylic acid, it is essential to wear appropriate perso...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...