Compound Q&A

What are the physical and chemical properties of 6-((3-((tert-Butyldimethylsilyloxy)methyl)pyrrolidin-1-yl)methyl)-2-(trimethylsilyl)furo[3,2-b]pyridine (CAS: 1188993-09-0)?

Answer

6-((3-((tert-Butyldimethylsilyloxy)methyl)pyrrolidin-1-yl)methyl)-2-(trimethylsilyl)furo[3,2-b]pyridine
The compound is a crystalline solid with a molecular weight of approximately 625.5 g/mol. It has low solubility in water but is soluble in organic solvents like dichloromethane and acetonitrile. The compound exhibits moderate reactivity, particularly towards nucleophiles and bases. It is stable under normal conditions but should be stored in a dry and cool environment to avoid hydrolysis.

About

English Name 6-((3-((tert-Butyldimethylsilyloxy)methyl)pyrrolidin-1-yl)methyl)-2-(trimethylsilyl)furo[3,2-b]pyridine
Molecular Formula C22H38N2O2Si2
Molecular Weight 418.73 g/mol
SMILES CC(C)(C)[Si](C)(C)OCC1CCN(C1)CC2=CC3=C(C=C(O3)[Si](C)(C)C)N=C2
InChIKey FYIVFWBKWAFZGA-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

How is 6-((3-((tert-Butyldimethylsilyloxy)methyl)pyrrolidin-1-yl)methyl)-2-(trimethylsilyl)furo[3,2-b]pyridine (CAS: 1188993-09-0) typically synthesized?

The compound is typically synthesized via a multistep process involving the formation of a silyl eth...

Compound Q&A

What industries use 6-((3-((tert-Butyldimethylsilyloxy)methyl)pyrrolidin-1-yl)methyl)-2-(trimethylsilyl)furo[3,2-b]pyridine (CAS: 1188993-09-0)?

This compound is primarily used in pharmaceuticals and fine chemistry for the synthesis of drug inte...

Compound Q&A

What precautions should be taken when handling 6-((3-((tert-Butyldimethylsilyloxy)methyl)pyrrolidin-1-yl)methyl)-2-(trimethylsilyl)furo[3,2-b]pyridine (CAS: 1188993-09-0)?

Proper personal protective equipment (PPE) should be worn, including gloves, safety goggles, and a l...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...